C23H25N5O — CID 24912545
5-methyl-3-phenyl-4-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole (PubChem CID 24912545) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 5-methyl-3-phenyl-4-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-phenyl-4-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 24912545 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 5-methyl-3-phenyl-4-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole |
| SMILES | Cc1onc(-c2ccccc2)c1CN1CCc2nc(C3=NCCCC3)ncc2C1 |
| InChI | InChI=1S/C23H25N5O/c1-16-19(22(27-29-16)17-7-3-2-4-8-17)15-28-12-10-20-18(14-28)13-25-23(26-20)21-9-5-6-11-24-21/h2-4,7-8,13H,5-6,9-12,14-15H2,1H3 |
| InChIKey | DDLZSAOXPOESJT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |