C23H25N5O2 — CID 24916094
5-(4-methoxyphenyl)-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole (PubChem CID 24916094) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole.
| Compound Name | 5-(4-methoxyphenyl)-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 24916094 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(CN3CCc4nc(C5=NCCCC5)ncc4C3)no2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-29-19-7-5-16(6-8-19)22-12-18(27-30-22)15-28-11-9-20-17(14-28)13-25-23(26-20)21-4-2-3-10-24-21/h5-8,12-13H,2-4,9-11,14-15H2,1H3 |
| InChIKey | KJWHHZGMWZOQQT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |