C25H23N3O3S — CID 2491302
2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1,3-benzothiazol-2-yl)-N-(2,6-dimethylphenyl)acetamide (PubChem CID 2491302) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1,3-benzothiazol-2-yl)-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1,3-benzothiazol-2-yl)-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2491302 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1,3-benzothiazol-2-yl)-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1N(C(=O)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H23N3O3S/c1-15-8-7-9-16(2)22(15)28(25-26-19-12-5-6-13-20(19)32-25)21(29)14-27-23(30)17-10-3-4-11-18(17)24(27)31/h3-9,12-13,17-18H,10-11,14H2,1-2H3/t17-,18+ |
| InChIKey | HQIVADZLMNZRML-HDICACEKSA-N |
| XLogP | 4.53 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|