C24H16N4O5S — CID 55333382
N-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55333382) has the molecular formula C24H16N4O5S and a molecular weight of 472.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55333382 |
| Molecular Formula | C24H16N4O5S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1ccccc1N(C(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H16N4O5S/c1-14-7-2-4-10-17(14)27(24-25-16-9-3-5-12-19(16)34-24)20(29)13-26-22(30)15-8-6-11-18(28(32)33)21(15)23(26)31/h2-12H,13H2,1H3 |
| InChIKey | OPGNQKHNBKSEQD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|