C18H11Cl2N3O3S — CID 34252201
N-(1,3-benzothiazol-2-yl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-methylacetamide (PubChem CID 34252201) has the molecular formula C18H11Cl2N3O3S and a molecular weight of 420.28 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 34252201 |
| Molecular Formula | C18H11Cl2N3O3S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H11Cl2N3O3S/c1-22(18-21-13-4-2-3-5-14(13)27-18)15(24)8-23-16(25)9-6-11(19)12(20)7-10(9)17(23)26/h2-7H,8H2,1H3 |
| InChIKey | CAUVNRFXGQGEQQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|