C18H23N3O2S — CID 95899814
2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-(1,3-benzothiazol-2-yl)-N-methylacetamide (PubChem CID 95899814) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-(1,3-benzothiazol-2-yl)-N-methylacetamide.
| Compound Name | 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-(1,3-benzothiazol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 95899814 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-(1,3-benzothiazol-2-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1CCO[C@@H]2CCCC[C@@H]21)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H23N3O2S/c1-20(18-19-13-6-2-5-9-16(13)24-18)17(22)12-21-10-11-23-15-8-4-3-7-14(15)21/h2,5-6,9,14-15H,3-4,7-8,10-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | OMJAPGMVOIXOBJ-LSDHHAIUSA-N |
| XLogP | 2.90 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |