C24H26N6 — CID 24913143
4-[6-[(1-propylbenzimidazol-2-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24913143) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[6-[(1-propylbenzimidazol-2-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(1-propylbenzimidazol-2-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24913143 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4-[6-[(1-propylbenzimidazol-2-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | CCCn1c(CN2CCc3nc(-c4ccc(N)cc4)ncc3C2)nc2ccccc21 |
| InChI | InChI=1S/C24H26N6/c1-2-12-30-22-6-4-3-5-21(22)27-23(30)16-29-13-11-20-18(15-29)14-26-24(28-20)17-7-9-19(25)10-8-17/h3-10,14H,2,11-13,15-16,25H2,1H3 |
| InChIKey | BISAAASQHRDPIV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|