C25H18Cl2N4O — CID 2492889
2-[[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 2492889) has the molecular formula C25H18Cl2N4O and a molecular weight of 461.35 g/mol. Its IUPAC name is 2-[[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | 2-[[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 2492889 |
| Molecular Formula | C25H18Cl2N4O |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(Cl)c1C=NN=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N4O/c1-17-22(25(27)31(30-17)21-14-12-20(26)13-15-21)16-28-29-23(18-8-4-2-5-9-18)24(32)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | BLYRDTHLUNLYRM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|