C25H25N3O6 — CID 24936412
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[5-[5-(hydroxyamino)-5-oxopentyl]-1H-indol-3-yl]propanoate (PubChem CID 24936412) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[5-[5-(hydroxyamino)-5-oxopentyl]-1H-indol-3-yl]propanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[5-[5-(hydroxyamino)-5-oxopentyl]-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 24936412 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[5-[5-(hydroxyamino)-5-oxopentyl]-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccc(CCCCC(=O)NO)cc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H25N3O6/c1-34-25(32)21(28-23(30)17-7-3-4-8-18(17)24(28)31)13-16-14-26-20-11-10-15(12-19(16)20)6-2-5-9-22(29)27-33/h3-4,7-8,10-12,14,21,26,33H,2,5-6,9,13H2,1H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | IACMCTUQDIBTSY-NRFANRHFSA-N |
| XLogP | 2.77 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|