C25H20N2O6 — CID 59808943
5-[3-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]-1H-indol-6-yl]pent-4-ynoic acid (PubChem CID 59808943) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is 5-[3-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]-1H-indol-6-yl]pent-4-ynoic acid.
| Compound Name | 5-[3-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]-1H-indol-6-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 59808943 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-[3-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]-1H-indol-6-yl]pent-4-ynoic acid |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2cc(C#CCCC(=O)O)ccc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H20N2O6/c1-33-25(32)21(27-23(30)18-7-3-4-8-19(18)24(27)31)13-16-14-26-20-12-15(10-11-17(16)20)6-2-5-9-22(28)29/h3-4,7-8,10-12,14,21,26H,5,9,13H2,1H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | IGTHKEYLSQGSLV-NRFANRHFSA-N |
| XLogP | 2.76 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|