C21H40O4Si — CID 24938415
[(Z)-1-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]oct-1-en-2-yl] acetate (PubChem CID 24938415) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is [(Z)-1-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]oct-1-en-2-yl] acetate.
| Compound Name | [(Z)-1-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]oct-1-en-2-yl] acetate |
|---|---|
| PubChem CID | 24938415 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(Z)-1-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]oct-1-en-2-yl] acetate |
| SMILES | CCCCCC/C(=C/[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CCO1)OC(C)=O |
| InChI | InChI=1S/C21H40O4Si/c1-8-9-10-11-12-18(24-17(2)22)15-20-16-19(13-14-23-20)25-26(6,7)21(3,4)5/h15,19-20H,8-14,16H2,1-7H3/b18-15-/t19-,20+/m1/s1 |
| InChIKey | LVSWRRWXNXOSEJ-NGOBHPGJSA-N |
| XLogP | 5.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|