C16H28Si — CID 24938522
2,2-dimethyl-1,3-dipropyl-4,5,6,7-tetrahydro-2-benzosilole (PubChem CID 24938522) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dipropyl-4,5,6,7-tetrahydro-2-benzosilole.
| Compound Name | 2,2-dimethyl-1,3-dipropyl-4,5,6,7-tetrahydro-2-benzosilole |
|---|---|
| PubChem CID | 24938522 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2,2-dimethyl-1,3-dipropyl-4,5,6,7-tetrahydro-2-benzosilole |
| SMILES | CCCC1=C2CCCCC2=C(CCC)[Si]1(C)C |
| InChI | InChI=1S/C16H28Si/c1-5-9-15-13-11-7-8-12-14(13)16(10-6-2)17(15,3)4/h5-12H2,1-4H3 |
| InChIKey | PGEKDFMWNXALDR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|