C13H22Si — CID 57101281
trimethyl(4,5,6,7-tetrahydro-2H-inden-2-ylmethyl)silane (PubChem CID 57101281) has the molecular formula C13H22Si and a molecular weight of 206.40 g/mol. Its IUPAC name is trimethyl(4,5,6,7-tetrahydro-2H-inden-2-ylmethyl)silane.
| Compound Name | trimethyl(4,5,6,7-tetrahydro-2H-inden-2-ylmethyl)silane |
|---|---|
| PubChem CID | 57101281 |
| Molecular Formula | C13H22Si |
| Molecular Weight | 206.40 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | trimethyl(4,5,6,7-tetrahydro-2H-inden-2-ylmethyl)silane |
| SMILES | C[Si](C)(C)CC1C=C2CCCCC2=C1 |
| InChI | InChI=1S/C13H22Si/c1-14(2,3)10-11-8-12-6-4-5-7-13(12)9-11/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | NFTPQYZQSJTAHL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|