C22H38O4 — CID 24938715
ethyl (3R,4R)-4-butyl-2-hydroxy-6-methyl-3-non-8-enyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 24938715) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is ethyl (3R,4R)-4-butyl-2-hydroxy-6-methyl-3-non-8-enyl-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl (3R,4R)-4-butyl-2-hydroxy-6-methyl-3-non-8-enyl-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 24938715 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | ethyl (3R,4R)-4-butyl-2-hydroxy-6-methyl-3-non-8-enyl-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=CCCCCCCC[C@H]1C(O)OC(C)=C(C(=O)OCC)[C@@H]1CCCC |
| InChI | InChI=1S/C22H38O4/c1-5-8-10-11-12-13-14-16-19-18(15-9-6-2)20(22(24)25-7-3)17(4)26-21(19)23/h5,18-19,21,23H,1,6-16H2,2-4H3/t18-,19-,21?/m1/s1 |
| InChIKey | LKTURPNMZNEHIJ-AQFHOAJTSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|