C16H28OSi — CID 24938975
[(1S,2R)-1-ethenyl-2-prop-2-ynylcyclopentyl]oxy-triethylsilane (PubChem CID 24938975) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclopentyl]oxy-triethylsilane.
| Compound Name | [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclopentyl]oxy-triethylsilane |
|---|---|
| PubChem CID | 24938975 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | [(1S,2R)-1-ethenyl-2-prop-2-ynylcyclopentyl]oxy-triethylsilane |
| SMILES | C#CC[C@H]1CCC[C@@]1(C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H28OSi/c1-6-12-15-13-11-14-16(15,7-2)17-18(8-3,9-4)10-5/h1,7,15H,2,8-14H2,3-5H3/t15-,16+/m0/s1 |
| InChIKey | XICNPOICFXQUDT-JKSUJKDBSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|