C27H25N3O5 — CID 24942668
2-[3-[3-[[3-methyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-4-yl]phenyl]acetic acid (PubChem CID 24942668) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-[3-[3-[[3-methyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-4-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[3-methyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-4-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24942668 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[3-[3-[[3-methyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-4-yl]phenyl]acetic acid |
| SMILES | Cc1c(C(=O)N2CCOCC2)c[nH]c1C=C1C(=O)Nc2cccc(-c3cccc(CC(=O)O)c3)c21 |
| InChI | InChI=1S/C27H25N3O5/c1-16-21(27(34)30-8-10-35-11-9-30)15-28-23(16)14-20-25-19(6-3-7-22(25)29-26(20)33)18-5-2-4-17(12-18)13-24(31)32/h2-7,12,14-15,28H,8-11,13H2,1H3,(H,29,33)(H,31,32) |
| InChIKey | PAECMNFMRDSPDR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|