C25H24N4O2 — CID 10136401
(3Z)-3-[[3-methyl-4-(piperidine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-pyridin-4-yl-1H-indol-2-one (PubChem CID 10136401) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3Z)-3-[[3-methyl-4-(piperidine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-pyridin-4-yl-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-methyl-4-(piperidine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-pyridin-4-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 10136401 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3Z)-3-[[3-methyl-4-(piperidine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-pyridin-4-yl-1H-indol-2-one |
| SMILES | Cc1c(C(=O)N2CCCCC2)c[nH]c1/C=C1\C(=O)Nc2cccc(-c3ccncc3)c21 |
| InChI | InChI=1S/C25H24N4O2/c1-16-20(25(31)29-12-3-2-4-13-29)15-27-22(16)14-19-23-18(17-8-10-26-11-9-17)6-5-7-21(23)28-24(19)30/h5-11,14-15,27H,2-4,12-13H2,1H3,(H,28,30)/b19-14- |
| InChIKey | ZZPFSVWZUUNSBQ-RGEXLXHISA-N |
| XLogP | 4.50 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|