C20H25ClO7 — CID 24944429
(1R,3S,9S,11S,12S,14R,15R,16S,17S,18S)-15-chloro-9,17,18-trihydroxy-11-methyl-16-propan-2-yl-6,13,19-trioxahexacyclo[14.2.1.03,11.04,8.012,14.012,18]nonadec-4(8)-en-7-one (PubChem CID 24944429) has the molecular formula C20H25ClO7 and a molecular weight of 412.87 g/mol. Its IUPAC name is (1R,3S,9S,11S,12S,14R,15R,16S,17S,18S)-15-chloro-9,17,18-trihydroxy-11-methyl-16-propan-2-yl-6,13,19-trioxahexacyclo[14.2.1.03,11.04,8.012,14.012,18]nonadec-4(8)-en-7-one.
| Compound Name | (1R,3S,9S,11S,12S,14R,15R,16S,17S,18S)-15-chloro-9,17,18-trihydroxy-11-methyl-16-propan-2-yl-6,13,19-trioxahexacyclo[14.2.1.03,11.04,8.012,14.012,18]nonadec-4(8)-en-7-one |
|---|---|
| PubChem CID | 24944429 |
| Molecular Formula | C20H25ClO7 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (1R,3S,9S,11S,12S,14R,15R,16S,17S,18S)-15-chloro-9,17,18-trihydroxy-11-methyl-16-propan-2-yl-6,13,19-trioxahexacyclo[14.2.1.03,11.04,8.012,14.012,18]nonadec-4(8)-en-7-one |
| SMILES | CC(C)[C@@]12O[C@@H]3C[C@H]4C5=C(C(=O)OC5)[C@@H](O)C[C@]4(C)[C@@]4(O[C@H]4[C@H]1Cl)[C@]3(O)[C@@H]2O |
| InChI | InChI=1S/C20H25ClO7/c1-7(2)18-13(21)14-20(28-14)17(3)5-10(22)12-8(6-26-15(12)23)9(17)4-11(27-18)19(20,25)16(18)24/h7,9-11,13-14,16,22,24-25H,4-6H2,1-3H3/t9-,10-,11+,13+,14-,16+,17-,18+,19+,20+/m0/s1 |
| InChIKey | UILXTGWHGZXHRM-YHWQBJCASA-N |
| XLogP | 0.27 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|