C22H32O4 — CID 166656080
(1S,2S,4S,5R,8R,11S)-5-hydroxy-1,6,6,7,8,17-hexamethyl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one (PubChem CID 166656080) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (1S,2S,4S,5R,8R,11S)-5-hydroxy-1,6,6,7,8,17-hexamethyl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one.
| Compound Name | (1S,2S,4S,5R,8R,11S)-5-hydroxy-1,6,6,7,8,17-hexamethyl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one |
|---|---|
| PubChem CID | 166656080 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1S,2S,4S,5R,8R,11S)-5-hydroxy-1,6,6,7,8,17-hexamethyl-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadec-12(16)-en-15-one |
| SMILES | CC1C[C@@]2(C)[C@@H](CC[C@]3(C)C(C)C(C)(C)[C@@H](O)[C@@H]4O[C@]423)C2=C1C(=O)OC2 |
| InChI | InChI=1S/C22H32O4/c1-11-9-21(6)14(13-10-25-18(24)15(11)13)7-8-20(5)12(2)19(3,4)16(23)17-22(20,21)26-17/h11-12,14,16-17,23H,7-10H2,1-6H3/t11?,12?,14-,16-,17-,20+,21-,22-/m0/s1 |
| InChIKey | MDSWJICUHJGGEZ-PESFAZAYSA-N |
| XLogP | 3.48 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|