C26H31N3O3 — CID 24947445
tert-butyl 2-(phenylmethoxymethyl)-4-quinolin-4-ylpiperazine-1-carboxylate (PubChem CID 24947445) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl 2-(phenylmethoxymethyl)-4-quinolin-4-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(phenylmethoxymethyl)-4-quinolin-4-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 24947445 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl 2-(phenylmethoxymethyl)-4-quinolin-4-ylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccnc3ccccc23)CC1COCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O3/c1-26(2,3)32-25(30)29-16-15-28(24-13-14-27-23-12-8-7-11-22(23)24)17-21(29)19-31-18-20-9-5-4-6-10-20/h4-14,21H,15-19H2,1-3H3 |
| InChIKey | JZBRWAAKJHUYLK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |