C25H29N3O2 — CID 24947264
tert-butyl 2-benzyl-4-quinolin-4-ylpiperazine-1-carboxylate (PubChem CID 24947264) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is tert-butyl 2-benzyl-4-quinolin-4-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-benzyl-4-quinolin-4-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 24947264 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | tert-butyl 2-benzyl-4-quinolin-4-ylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccnc3ccccc23)CC1Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c1-25(2,3)30-24(29)28-16-15-27(18-20(28)17-19-9-5-4-6-10-19)23-13-14-26-22-12-8-7-11-21(22)23/h4-14,20H,15-18H2,1-3H3 |
| InChIKey | SFNICXNQWQQLGZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |