C26H31N3O2 — CID 24948577
tert-butyl 2-benzyl-4-(isoquinolin-5-ylmethyl)piperazine-1-carboxylate (PubChem CID 24948577) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl 2-benzyl-4-(isoquinolin-5-ylmethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-benzyl-4-(isoquinolin-5-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 24948577 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl 2-benzyl-4-(isoquinolin-5-ylmethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cccc3cnccc23)CC1Cc1ccccc1 |
| InChI | InChI=1S/C26H31N3O2/c1-26(2,3)31-25(30)29-15-14-28(19-23(29)16-20-8-5-4-6-9-20)18-22-11-7-10-21-17-27-13-12-24(21)22/h4-13,17,23H,14-16,18-19H2,1-3H3 |
| InChIKey | BDBIXQQDNPKSLE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |