C30H32ClN3O4S2 — CID 24949964
5-[(3-chlorophenyl)methylamino]-N-(3-cyclohexylsulfanylpropyl)-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 24949964) has the molecular formula C30H32ClN3O4S2 and a molecular weight of 598.19 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylamino]-N-(3-cyclohexylsulfanylpropyl)-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methylamino]-N-(3-cyclohexylsulfanylpropyl)-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 24949964 |
| Molecular Formula | C30H32ClN3O4S2 |
| Molecular Weight | 598.19 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | 5-[(3-chlorophenyl)methylamino]-N-(3-cyclohexylsulfanylpropyl)-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)c1ccc2c(c1)N(NCc1cccc(Cl)c1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C30H32ClN3O4S2/c31-23-9-6-8-21(18-23)20-33-34-26-19-22(29(35)32-16-7-17-39-24-10-2-1-3-11-24)14-15-28(26)40(37,38)27-13-5-4-12-25(27)30(34)36/h4-6,8-9,12-15,18-19,24,33H,1-3,7,10-11,16-17,20H2,(H,32,35) |
| InChIKey | LUDBBONNYMMIRA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.19 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|