C31H32ClN4O4+ — CID 24949974
benzyl-[[4-[(E)-3-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1-methyl-5-nitropyrrol-2-yl]methyl]-dimethylazanium (PubChem CID 24949974) has the molecular formula C31H32ClN4O4+ and a molecular weight of 560.07 g/mol. Its IUPAC name is benzyl-[[4-[(E)-3-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1-methyl-5-nitropyrrol-2-yl]methyl]-dimethylazanium.
| Compound Name | benzyl-[[4-[(E)-3-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1-methyl-5-nitropyrrol-2-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 24949974 |
| Molecular Formula | C31H32ClN4O4+ |
| Molecular Weight | 560.07 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | benzyl-[[4-[(E)-3-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1-methyl-5-nitropyrrol-2-yl]methyl]-dimethylazanium |
| SMILES | Cn1c(C[N+](C)(C)Cc2ccccc2)cc(/C=C/C(=O)N2CC(CCl)c3c2cc(O)c2ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C31H31ClN4O4/c1-33-24(20-36(2,3)19-21-9-5-4-6-10-21)15-22(31(33)35(39)40)13-14-29(38)34-18-23(17-32)30-26-12-8-7-11-25(26)28(37)16-27(30)34/h4-16,23H,17-20H2,1-3H3/p+1/b14-13+ |
| InChIKey | NCVJCHREMGENAX-BUHFOSPRSA-O |
| XLogP | 5.95 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.07 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|