C32H34N3O+ — CID 24949968
[4-[(E)-3-(5-amino-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-3-oxoprop-1-enyl]phenyl]methyl-benzyl-dimethylazanium (PubChem CID 24949968) has the molecular formula C32H34N3O+ and a molecular weight of 476.64 g/mol. Its IUPAC name is [4-[(E)-3-(5-amino-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-3-oxoprop-1-enyl]phenyl]methyl-benzyl-dimethylazanium.
| Compound Name | [4-[(E)-3-(5-amino-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-3-oxoprop-1-enyl]phenyl]methyl-benzyl-dimethylazanium |
|---|---|
| PubChem CID | 24949968 |
| Molecular Formula | C32H34N3O+ |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | [4-[(E)-3-(5-amino-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-3-oxoprop-1-enyl]phenyl]methyl-benzyl-dimethylazanium |
| SMILES | CC1CN(C(=O)/C=C/c2ccc(C[N+](C)(C)Cc3ccccc3)cc2)c2cc(N)c3ccccc3c21 |
| InChI | InChI=1S/C32H34N3O/c1-23-20-34(30-19-29(33)27-11-7-8-12-28(27)32(23)30)31(36)18-17-24-13-15-26(16-14-24)22-35(2,3)21-25-9-5-4-6-10-25/h4-19,23H,20-22,33H2,1-3H3/q+1/b18-17+ |
| InChIKey | AQTIPHPJLMUEKG-ISLYRVAYSA-N |
| XLogP | 6.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|