C23H21ClN2O2 — CID 5470144
(E)-1-[5-amino-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-3-yl]-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 5470144) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is (E)-1-[5-amino-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-3-yl]-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-amino-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-3-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5470144 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (E)-1-[5-amino-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-3-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CC(CCl)c3c2cc(N)c2ccccc32)c1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-28-17-6-4-5-15(11-17)9-10-22(27)26-14-16(13-24)23-19-8-3-2-7-18(19)20(25)12-21(23)26/h2-12,16H,13-14,25H2,1H3/b10-9+ |
| InChIKey | VRBJCJNVLXEKKP-MDZDMXLPSA-N |
| XLogP | 4.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|