C22H19ClN2O4 — CID 91052808
1-(chloromethyl)-3-[3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one (PubChem CID 91052808) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 1-(chloromethyl)-3-[3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one.
| Compound Name | 1-(chloromethyl)-3-[3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
|---|---|
| PubChem CID | 91052808 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(chloromethyl)-3-[3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
| SMILES | COc1ccc(C=CC(=O)N2CC(CCl)c3c2ccc2[nH]c(=O)ccc32)cc1O |
| InChI | InChI=1S/C22H19ClN2O4/c1-29-19-7-2-13(10-18(19)26)3-9-21(28)25-12-14(11-23)22-15-4-8-20(27)24-16(15)5-6-17(22)25/h2-10,14,26H,11-12H2,1H3,(H,24,27) |
| InChIKey | SQARRBBEBRHMCC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|