C23H22ClN2O2+ — CID 147947071
[1-(chloromethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-1,2-dihydrobenzo[e]indol-5-yl]azanium (PubChem CID 147947071) has the molecular formula C23H22ClN2O2+ and a molecular weight of 393.89 g/mol. Its IUPAC name is [1-(chloromethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-1,2-dihydrobenzo[e]indol-5-yl]azanium.
| Compound Name | [1-(chloromethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-1,2-dihydrobenzo[e]indol-5-yl]azanium |
|---|---|
| PubChem CID | 147947071 |
| Molecular Formula | C23H22ClN2O2+ |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [1-(chloromethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-1,2-dihydrobenzo[e]indol-5-yl]azanium |
| SMILES | COc1ccc(C=CC(=O)N2CC(CCl)c3c2cc([NH3+])c2ccccc32)cc1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-28-17-9-6-15(7-10-17)8-11-22(27)26-14-16(13-24)23-19-5-3-2-4-18(19)20(25)12-21(23)26/h2-12,16H,13-14,25H2,1H3/p+1 |
| InChIKey | IMWKRMJFEUPBBH-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|