C24H20ClNO4Se — CID 71542121
[1-(chloromethyl)-5-hydroxy-8-methoxy-1,2-dihydrobenzo[e]indol-3-yl]-(5-methoxy-1-benzoselenophen-2-yl)methanone (PubChem CID 71542121) has the molecular formula C24H20ClNO4Se and a molecular weight of 500.84 g/mol. Its IUPAC name is [1-(chloromethyl)-5-hydroxy-8-methoxy-1,2-dihydrobenzo[e]indol-3-yl]-(5-methoxy-1-benzoselenophen-2-yl)methanone.
| Compound Name | [1-(chloromethyl)-5-hydroxy-8-methoxy-1,2-dihydrobenzo[e]indol-3-yl]-(5-methoxy-1-benzoselenophen-2-yl)methanone |
|---|---|
| PubChem CID | 71542121 |
| Molecular Formula | C24H20ClNO4Se |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | [1-(chloromethyl)-5-hydroxy-8-methoxy-1,2-dihydrobenzo[e]indol-3-yl]-(5-methoxy-1-benzoselenophen-2-yl)methanone |
| SMILES | COc1ccc2[se]c(C(=O)N3CC(CCl)c4c3cc(O)c3ccc(OC)cc43)cc2c1 |
| InChI | InChI=1S/C24H20ClNO4Se/c1-29-15-4-6-21-13(7-15)8-22(31-21)24(28)26-12-14(11-25)23-18-9-16(30-2)3-5-17(18)20(27)10-19(23)26/h3-10,14,27H,11-12H2,1-2H3 |
| InChIKey | FHEFFZLQGMHFDR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|