C24H37ClN2O3 — CID 24951014
(3E,5S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-[[(2S)-pyrrolidin-2-yl]methoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione;hydrochloride (PubChem CID 24951014) has the molecular formula C24H37ClN2O3 and a molecular weight of 437.02 g/mol. Its IUPAC name is (3E,5S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-[[(2S)-pyrrolidin-2-yl]methoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione;hydrochloride.
| Compound Name | (3E,5S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-[[(2S)-pyrrolidin-2-yl]methoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione;hydrochloride |
|---|---|
| PubChem CID | 24951014 |
| Molecular Formula | C24H37ClN2O3 |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (3E,5S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-[[(2S)-pyrrolidin-2-yl]methoxyimino]-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione;hydrochloride |
| SMILES | C[C@]12CC/C(=N\OC[C@@H]3CCCN3)C[C@@H]1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C24H36N2O3.ClH/c1-23-9-7-15(26-29-14-16-4-3-11-25-16)12-20(23)21(27)13-17-18-5-6-22(28)24(18,2)10-8-19(17)23;/h16-20,25H,3-14H2,1-2H3;1H/b26-15+;/t16-,17-,18-,19-,20+,23+,24-;/m0./s1 |
| InChIKey | WRMOJVQCKMGGJD-RYAKPCLESA-N |
| XLogP | 4.32 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|