C36H56Si2 — CID 24951131
[(5R,10R)-5,10-dimethyl-10-tri(propan-2-yl)silylindeno[2,1-a]inden-5-yl]-tri(propan-2-yl)silane (PubChem CID 24951131) has the molecular formula C36H56Si2 and a molecular weight of 545.02 g/mol. Its IUPAC name is [(5R,10R)-5,10-dimethyl-10-tri(propan-2-yl)silylindeno[2,1-a]inden-5-yl]-tri(propan-2-yl)silane.
| Compound Name | [(5R,10R)-5,10-dimethyl-10-tri(propan-2-yl)silylindeno[2,1-a]inden-5-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 24951131 |
| Molecular Formula | C36H56Si2 |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | [(5R,10R)-5,10-dimethyl-10-tri(propan-2-yl)silylindeno[2,1-a]inden-5-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)[C@@]1(C)C2=C(c3ccccc31)[C@](C)([Si](C(C)C)(C(C)C)C(C)C)c1ccccc12 |
| InChI | InChI=1S/C36H56Si2/c1-23(2)37(24(3)4,25(5)6)35(13)31-21-17-15-19-29(31)34-33(35)30-20-16-18-22-32(30)36(34,14)38(26(7)8,27(9)10)28(11)12/h15-28H,1-14H3/t35-,36-/m1/s1 |
| InChIKey | HUQVHNQMHUHRAT-LQFQNGICSA-N |
| XLogP | 11.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|