C21H32N4O2S — CID 24951582
(E)-3-[2-tert-butyl-3-[[ethyl(3-methylsulfanylpropyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 24951582) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is (E)-3-[2-tert-butyl-3-[[ethyl(3-methylsulfanylpropyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-tert-butyl-3-[[ethyl(3-methylsulfanylpropyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 24951582 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (E)-3-[2-tert-butyl-3-[[ethyl(3-methylsulfanylpropyl)amino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCN(CCCSC)Cc1c(C(C)(C)C)nc2cc(/C=C/C(=O)NO)ccn12 |
| InChI | InChI=1S/C21H32N4O2S/c1-6-24(11-7-13-28-5)15-17-20(21(2,3)4)22-18-14-16(10-12-25(17)18)8-9-19(26)23-27/h8-10,12,14,27H,6-7,11,13,15H2,1-5H3,(H,23,26)/b9-8+ |
| InChIKey | NWGRUDOZZVARNF-CMDGGOBGSA-N |
| XLogP | 3.73 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|