C22H27F3N2O2 — CID 24952609
1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]imidazolidin-2-one (PubChem CID 24952609) has the molecular formula C22H27F3N2O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]imidazolidin-2-one.
| Compound Name | 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 24952609 |
| Molecular Formula | C22H27F3N2O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]imidazolidin-2-one |
| SMILES | C[C@@H](c1cccc(C(F)(F)F)c1)N1CCN(C2C3CC4CC2CC(O)(C4)C3)C1=O |
| InChI | InChI=1S/C22H27F3N2O2/c1-13(15-3-2-4-18(9-15)22(23,24)25)26-5-6-27(20(26)28)19-16-7-14-8-17(19)12-21(29,10-14)11-16/h2-4,9,13-14,16-17,19,29H,5-8,10-12H2,1H3/t13-,14?,16?,17?,19?,21?/m0/s1 |
| InChIKey | NBKUPLYRHAUQQF-CPQINVFFSA-N |
| XLogP | 4.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |