C22H18N2O3S — CID 24953843
5-[2-(4-hydroxy-3-methylphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide (PubChem CID 24953843) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 5-[2-(4-hydroxy-3-methylphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide.
| Compound Name | 5-[2-(4-hydroxy-3-methylphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24953843 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 5-[2-(4-hydroxy-3-methylphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
| SMILES | Cc1cc(C#Cc2cncc(C(=O)N=[S@@](C)(=O)c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C22H18N2O3S/c1-16-12-17(10-11-21(16)25)8-9-18-13-19(15-23-14-18)22(26)24-28(2,27)20-6-4-3-5-7-20/h3-7,10-15,25H,1-2H3/t28-/m0/s1 |
| InChIKey | XVWSOMRAGRJJBY-NDEPHWFRSA-N |
| XLogP | 3.79 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|