C10H16NO14P3 — CID 24955113
[[(2R,3S,4R,5S)-3,4-dihydroxy-5-pyridin-3-yloxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 24955113) has the molecular formula C10H16NO14P3 and a molecular weight of 467.15 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-3,4-dihydroxy-5-pyridin-3-yloxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-3,4-dihydroxy-5-pyridin-3-yloxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 24955113 |
| Molecular Formula | C10H16NO14P3 |
| Molecular Weight | 467.15 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | [[(2R,3S,4R,5S)-3,4-dihydroxy-5-pyridin-3-yloxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](Oc2cccnc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16NO14P3/c12-8-7(23-10(9(8)13)22-6-2-1-3-11-4-6)5-21-27(17,18)25-28(19,20)24-26(14,15)16/h1-4,7-10,12-13H,5H2,(H,17,18)(H,19,20)(H2,14,15,16)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | LMRAZSFXGNSMSB-ZYUZMQFOSA-N |
| XLogP | -0.75 |
| TPSA | 231.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.15 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|