C14H24NO14P3 — CID 58446430
[[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(4-methoxy-N-methylanilino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58446430) has the molecular formula C14H24NO14P3 and a molecular weight of 523.26 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(4-methoxy-N-methylanilino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(4-methoxy-N-methylanilino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58446430 |
| Molecular Formula | C14H24NO14P3 |
| Molecular Weight | 523.26 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | [[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(4-methoxy-N-methylanilino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1ccc(N(C)C[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H24NO14P3/c1-15(9-3-5-10(25-2)6-4-9)7-11-13(16)14(17)12(27-11)8-26-31(21,22)29-32(23,24)28-30(18,19)20/h3-6,11-14,16-17H,7-8H2,1-2H3,(H,21,22)(H,23,24)(H2,18,19,20)/t11-,12+,13-,14+/m0/s1 |
| InChIKey | MISQLECFSMNZCT-RFQIPJPRSA-N |
| XLogP | -0.04 |
| TPSA | 221.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|