C22H25N3O — CID 24956249
2-(2-phenylquinazolin-4-yl)-N,N-di(propan-2-yl)acetamide (PubChem CID 24956249) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(2-phenylquinazolin-4-yl)-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(2-phenylquinazolin-4-yl)-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 24956249 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-(2-phenylquinazolin-4-yl)-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)Cc1nc(-c2ccccc2)nc2ccccc12)C(C)C |
| InChI | InChI=1S/C22H25N3O/c1-15(2)25(16(3)4)21(26)14-20-18-12-8-9-13-19(18)23-22(24-20)17-10-6-5-7-11-17/h5-13,15-16H,14H2,1-4H3 |
| InChIKey | LYRAICSKSQZHQK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |