C36H31ClF3N5O3 — CID 24956335
3-(4-acetamidopiperidin-1-yl)-N-[3-(7-chloro-2-oxo-1-phenyl-1,6-naphthyridin-3-yl)-4-methylphenyl]-5-(trifluoromethyl)benzamide (PubChem CID 24956335) has the molecular formula C36H31ClF3N5O3 and a molecular weight of 674.12 g/mol. Its IUPAC name is 3-(4-acetamidopiperidin-1-yl)-N-[3-(7-chloro-2-oxo-1-phenyl-1,6-naphthyridin-3-yl)-4-methylphenyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-(4-acetamidopiperidin-1-yl)-N-[3-(7-chloro-2-oxo-1-phenyl-1,6-naphthyridin-3-yl)-4-methylphenyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24956335 |
| Molecular Formula | C36H31ClF3N5O3 |
| Molecular Weight | 674.12 g/mol |
| Exact Mass | 673.21 |
| IUPAC Name | 3-(4-acetamidopiperidin-1-yl)-N-[3-(7-chloro-2-oxo-1-phenyl-1,6-naphthyridin-3-yl)-4-methylphenyl]-5-(trifluoromethyl)benzamide |
| SMILES | CC(=O)NC1CCN(c2cc(C(=O)Nc3ccc(C)c(-c4cc5cnc(Cl)cc5n(-c5ccccc5)c4=O)c3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C36H31ClF3N5O3/c1-21-8-9-27(18-30(21)31-16-24-20-41-33(37)19-32(24)45(35(31)48)28-6-4-3-5-7-28)43-34(47)23-14-25(36(38,39)40)17-29(15-23)44-12-10-26(11-13-44)42-22(2)46/h3-9,14-20,26H,10-13H2,1-2H3,(H,42,46)(H,43,47) |
| InChIKey | LLUUASVFQSBVHO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.12 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|