C18H17Cl2NO4 — CID 24959221
2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxy-2-prop-2-enoxyphenyl)ethanone (PubChem CID 24959221) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxy-2-prop-2-enoxyphenyl)ethanone.
| Compound Name | 2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxy-2-prop-2-enoxyphenyl)ethanone |
|---|---|
| PubChem CID | 24959221 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxy-2-prop-2-enoxyphenyl)ethanone |
| SMILES | C=CCOc1c(C(=O)Cc2c(Cl)cncc2Cl)ccc(OC)c1OC |
| InChI | InChI=1S/C18H17Cl2NO4/c1-4-7-25-17-11(5-6-16(23-2)18(17)24-3)15(22)8-12-13(19)9-21-10-14(12)20/h4-6,9-10H,1,7-8H2,2-3H3 |
| InChIKey | AJIKUSBBLVSZLH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|