C24H21Cl2NO6 — CID 24960331
benzyl 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetate (PubChem CID 24960331) has the molecular formula C24H21Cl2NO6 and a molecular weight of 490.34 g/mol. Its IUPAC name is benzyl 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetate.
| Compound Name | benzyl 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 24960331 |
| Molecular Formula | C24H21Cl2NO6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | benzyl 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetate |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)c(OCC(=O)OCc2ccccc2)c1OC |
| InChI | InChI=1S/C24H21Cl2NO6/c1-30-21-9-8-16(20(28)10-17-18(25)11-27-12-19(17)26)23(24(21)31-2)33-14-22(29)32-13-15-6-4-3-5-7-15/h3-9,11-12H,10,13-14H2,1-2H3 |
| InChIKey | UOQJISLMCFWFNY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |