C20H22Cl2N2O5 — CID 91446208
2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]pentanamide (PubChem CID 91446208) has the molecular formula C20H22Cl2N2O5 and a molecular weight of 441.31 g/mol. Its IUPAC name is 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]pentanamide.
| Compound Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]pentanamide |
|---|---|
| PubChem CID | 91446208 |
| Molecular Formula | C20H22Cl2N2O5 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]pentanamide |
| SMILES | CCCC(Oc1c(C(=O)Cc2c(Cl)cncc2Cl)ccc(OC)c1OC)C(N)=O |
| InChI | InChI=1S/C20H22Cl2N2O5/c1-4-5-17(20(23)26)29-18-11(6-7-16(27-2)19(18)28-3)15(25)8-12-13(21)9-24-10-14(12)22/h6-7,9-10,17H,4-5,8H2,1-3H3,(H2,23,26) |
| InChIKey | KNZRDMCNBPQWJO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |