C30H43N7O6 — CID 24959508
methyl 2-[4-[[2-[(2S,6R)-3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-2,6-dimethylmorpholin-4-yl]pentanoylamino]methyl]phenyl]acetate (PubChem CID 24959508) has the molecular formula C30H43N7O6 and a molecular weight of 597.72 g/mol. Its IUPAC name is methyl 2-[4-[[2-[(2S,6R)-3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-2,6-dimethylmorpholin-4-yl]pentanoylamino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[2-[(2S,6R)-3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-2,6-dimethylmorpholin-4-yl]pentanoylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 24959508 |
| Molecular Formula | C30H43N7O6 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | methyl 2-[4-[[2-[(2S,6R)-3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-2,6-dimethylmorpholin-4-yl]pentanoylamino]methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(C3[C@H](C)O[C@H](C)CN3C(CCC)C(=O)NCc3ccc(CC(=O)OC)cc3)c2n1 |
| InChI | InChI=1S/C30H43N7O6/c1-6-8-14-42-29-34-25(31)24-26(35-29)37(30(40)33-24)28-19(4)43-18(3)17-36(28)22(9-7-2)27(39)32-16-21-12-10-20(11-13-21)15-23(38)41-5/h10-13,18-19,22,28H,6-9,14-17H2,1-5H3,(H,32,39)(H,33,40)(H2,31,34,35)/t18-,19+,22?,28?/m1/s1 |
| InChIKey | ASJGHVIXNLULTF-RQUJPQGZSA-N |
| XLogP | 2.69 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|