C26H24F26NO10P — CID 24964562
2-amino-3-[2,3-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 24964562) has the molecular formula C26H24F26NO10P and a molecular weight of 1035.40 g/mol. Its IUPAC name is 2-amino-3-[2,3-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[2,3-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 24964562 |
| Molecular Formula | C26H24F26NO10P |
| Molecular Weight | 1035.40 g/mol |
| Exact Mass | 1035.07 |
| IUPAC Name | 2-amino-3-[2,3-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | NC(COP(=O)(O)OCC(COC(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C26H24F26NO10P/c27-15(28,17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49)5-1-3-12(54)60-7-10(8-61-64(58,59)62-9-11(53)14(56)57)63-13(55)4-2-6-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52/h10-11H,1-9,53H2,(H,56,57)(H,58,59) |
| InChIKey | VYFFMBNIYNSYJZ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.40 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|