C23H23F2N5O2 — CID 24964886
(3E)-1-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 24964886) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is (3E)-1-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | (3E)-1-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 24964886 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (3E)-1-[(1S)-1-(2,6-difluoro-3-pyridinyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | COc1cc(/C=C2\CCCN([C@@H](C)c3ccc(F)nc3F)C2=O)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-14(18-7-9-21(24)27-22(18)25)29-10-4-5-17(23(29)31)11-16-6-8-19(20(12-16)32-3)30-13-26-15(2)28-30/h6-9,11-14H,4-5,10H2,1-3H3/b17-11+/t14-/m0/s1 |
| InChIKey | FLLDDUHVWGCTMX-MPMPPSQCSA-N |
| XLogP | 4.02 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|