C27H46F3NO2Si2 — CID 24965333
2-[(2S,4R)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]-2-(4-trimethylsilylphenyl)piperidin-4-yl]acetic acid (PubChem CID 24965333) has the molecular formula C27H46F3NO2Si2 and a molecular weight of 529.84 g/mol. Its IUPAC name is 2-[(2S,4R)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]-2-(4-trimethylsilylphenyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[(2S,4R)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]-2-(4-trimethylsilylphenyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 24965333 |
| Molecular Formula | C27H46F3NO2Si2 |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 2-[(2S,4R)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]-2-(4-trimethylsilylphenyl)piperidin-4-yl]acetic acid |
| SMILES | C[Si](C)(C)CC[C@@H](CCCCC(F)(F)F)N1CC[C@@H](CC(=O)O)C[C@H]1c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H46F3NO2Si2/c1-34(2,3)18-15-23(9-7-8-16-27(28,29)30)31-17-14-21(20-26(32)33)19-25(31)22-10-12-24(13-11-22)35(4,5)6/h10-13,21,23,25H,7-9,14-20H2,1-6H3,(H,32,33)/t21-,23-,25+/m1/s1 |
| InChIKey | ZXVDWGPBXCZQMR-PFATUAPWSA-N |
| XLogP | 7.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|