C27H44F3NO2Si — CID 24964983
2-[(2S,4R)-2-(4-propan-2-ylphenyl)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]piperidin-4-yl]acetic acid (PubChem CID 24964983) has the molecular formula C27H44F3NO2Si and a molecular weight of 499.73 g/mol. Its IUPAC name is 2-[(2S,4R)-2-(4-propan-2-ylphenyl)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(2S,4R)-2-(4-propan-2-ylphenyl)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 24964983 |
| Molecular Formula | C27H44F3NO2Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 2-[(2S,4R)-2-(4-propan-2-ylphenyl)-1-[(3R)-8,8,8-trifluoro-1-trimethylsilyloctan-3-yl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)c1ccc([C@@H]2C[C@H](CC(=O)O)CCN2[C@H](CCCCC(F)(F)F)CC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H44F3NO2Si/c1-20(2)22-9-11-23(12-10-22)25-18-21(19-26(32)33)13-16-31(25)24(14-17-34(3,4)5)8-6-7-15-27(28,29)30/h9-12,20-21,24-25H,6-8,13-19H2,1-5H3,(H,32,33)/t21-,24-,25+/m1/s1 |
| InChIKey | WVAFGPDIHGABRW-SDUSCBPUSA-N |
| XLogP | 8.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|