C13H16F2N2O — CID 24968609
(4S)-4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 24968609) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is (4S)-4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 24968609 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4S)-4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCC(C[C@H]1COC(N)=N1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2N2O/c1-2-8(5-10-7-18-13(16)17-10)9-3-4-11(14)12(15)6-9/h3-4,6,8,10H,2,5,7H2,1H3,(H2,16,17)/t8?,10-/m0/s1 |
| InChIKey | XRGFQKKCQUKQPE-HTLJXXAVSA-N |
| XLogP | 2.56 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |