C6H3F3N4 — CID 24975675
(Z)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile (PubChem CID 24975675) has the molecular formula C6H3F3N4 and a molecular weight of 188.11 g/mol. Its IUPAC name is (Z)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 24975675 |
| Molecular Formula | C6H3F3N4 |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | (Z)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
| SMILES | N#C/C=C\c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H3F3N4/c7-6(8,9)5-11-4(12-13-5)2-1-3-10/h1-2H,(H,11,12,13)/b2-1- |
| InChIKey | AQTSXXJJNLPEOU-UPHRSURJSA-N |
| XLogP | 1.36 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|