About 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole
3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole (PubChem CID 22956415) has the molecular formula C4H2F3N3
and a molecular weight of 149.08 g/mol. Its IUPAC name is 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole.
Analyze 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole?
The IUPAC name of 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole (CID 22956415) is 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole.
What is the SMILES notation for 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole?
The canonical SMILES for 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole is FC(F)=Cc1n[nH]c(F)n1.
What is the InChIKey of 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole?
The InChIKey is LTYSLLKURDNJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F3N3/c5-2(6)1-3-8-4(7)10-9-3/h1H,(H,8,9,10).
What are the key properties of 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole?
3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole has a molecular weight of 149.08 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole is sourced from PubChem (CID 22956415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).