C5H5F4N3 — CID 90743890
ethene;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 90743890) has the molecular formula C5H5F4N3 and a molecular weight of 183.11 g/mol. Its IUPAC name is ethene;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | ethene;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 90743890 |
| Molecular Formula | C5H5F4N3 |
| Molecular Weight | 183.11 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | ethene;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | C=C.Fc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C3HF4N3.C2H4/c4-2-8-1(9-10-2)3(5,6)7;1-2/h(H,8,9,10);1-2H2 |
| InChIKey | KYTXKSSMIJRUJE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|